C32H33F3N5O2+ — CID 177267659
2-[[4-(azepan-1-ium-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-[4-(azepan-1-yl)phenyl]methyl]-4-azido-3,5,6-trifluorobenzoic acid (PubChem CID 177267659) has the molecular formula C32H33F3N5O2+ and a molecular weight of 576.64 g/mol. Its IUPAC name is 2-[[4-(azepan-1-ium-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-[4-(azepan-1-yl)phenyl]methyl]-4-azido-3,5,6-trifluorobenzoic acid.
| Compound Name | 2-[[4-(azepan-1-ium-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-[4-(azepan-1-yl)phenyl]methyl]-4-azido-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 177267659 |
| Molecular Formula | C32H33F3N5O2+ |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 2-[[4-(azepan-1-ium-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-[4-(azepan-1-yl)phenyl]methyl]-4-azido-3,5,6-trifluorobenzoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)O)c(C(=C2C=CC(=[N+]3CCCCCC3)C=C2)c2ccc(N3CCCCCC3)cc2)c1F |
| InChI | InChI=1S/C32H32F3N5O2/c33-28-27(32(41)42)26(29(34)31(30(28)35)37-38-36)25(21-9-13-23(14-10-21)39-17-5-1-2-6-18-39)22-11-15-24(16-12-22)40-19-7-3-4-8-20-40/h9-16H,1-8,17-20H2/p+1 |
| InChIKey | UPAUYYHVHCMJQJ-UHFFFAOYSA-O |
| XLogP | 8.08 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|