C30H28F3N2O5S+ — CID 162159530
2,3,5-trifluoro-4-methyl-6-(3-morpholin-4-yl-10,10-dioxo-6-piperidin-1-ium-1-ylidenethioxanthen-9-yl)benzoic acid (PubChem CID 162159530) has the molecular formula C30H28F3N2O5S+ and a molecular weight of 585.62 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-methyl-6-(3-morpholin-4-yl-10,10-dioxo-6-piperidin-1-ium-1-ylidenethioxanthen-9-yl)benzoic acid.
| Compound Name | 2,3,5-trifluoro-4-methyl-6-(3-morpholin-4-yl-10,10-dioxo-6-piperidin-1-ium-1-ylidenethioxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 162159530 |
| Molecular Formula | C30H28F3N2O5S+ |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2,3,5-trifluoro-4-methyl-6-(3-morpholin-4-yl-10,10-dioxo-6-piperidin-1-ium-1-ylidenethioxanthen-9-yl)benzoic acid |
| SMILES | Cc1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+]4CCCCC4)C=C3S(=O)(=O)c3cc(N4CCOCC4)ccc32)c1F |
| InChI | InChI=1S/C30H27F3N2O5S/c1-17-27(31)25(26(30(36)37)29(33)28(17)32)24-20-7-5-18(34-9-3-2-4-10-34)15-22(20)41(38,39)23-16-19(6-8-21(23)24)35-11-13-40-14-12-35/h5-8,15-16H,2-4,9-14H2,1H3/p+1 |
| InChIKey | VBBQHNMXVGARMH-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|