C31H23F3N4O6S — CID 162450198
2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dioxothioxanthen-9-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoate (PubChem CID 162450198) has the molecular formula C31H23F3N4O6S and a molecular weight of 636.61 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dioxothioxanthen-9-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoate.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dioxothioxanthen-9-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoate |
|---|---|
| PubChem CID | 162450198 |
| Molecular Formula | C31H23F3N4O6S |
| Molecular Weight | 636.61 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)-10,10-dioxothioxanthen-9-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoate |
| SMILES | COCOC(C#N)(C#N)c1c(F)c(F)c(C(=O)[O-])c(C2=C3C=CC(=[N+]4CCC4)C=C3S(=O)(=O)c3cc(N4CCC4)ccc32)c1F |
| InChI | InChI=1S/C31H23F3N4O6S/c1-43-16-44-31(14-35,15-36)26-27(32)24(25(30(39)40)28(33)29(26)34)23-19-6-4-17(37-8-2-9-37)12-21(19)45(41,42)22-13-18(5-7-20(22)23)38-10-3-11-38/h4-7,12-13H,2-3,8-11,16H2,1H3 |
| InChIKey | RRVJVIXPWNYCND-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 146.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.61 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|