C37H29F3N4O5P+ — CID 162450223
2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoic acid (PubChem CID 162450223) has the molecular formula C37H29F3N4O5P+ and a molecular weight of 697.63 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoic acid.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 162450223 |
| Molecular Formula | C37H29F3N4O5P+ |
| Molecular Weight | 697.63 g/mol |
| Exact Mass | 697.18 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-(azetidin-1-yl)-5-oxo-5-phenylacridophosphin-10-yl]-4-[dicyano(methoxymethoxy)methyl]-3,5,6-trifluorobenzoic acid |
| SMILES | COCOC(C#N)(C#N)c1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+]4CCC4)C=C3P(=O)(c3ccccc3)c3cc(N4CCC4)ccc32)c1F |
| InChI | InChI=1S/C37H28F3N4O5P/c1-48-21-49-37(19-41,20-42)32-33(38)30(31(36(45)46)34(39)35(32)40)29-25-11-9-22(43-13-5-14-43)17-27(25)50(47,24-7-3-2-4-8-24)28-18-23(10-12-26(28)29)44-15-6-16-44/h2-4,7-12,17-18H,5-6,13-16,21H2,1H3/p+1 |
| InChIKey | ZYPRWRILCKYHMC-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|