C31H26F2N2OP+ — CID 167484582
3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,10-diphenylacridophosphine 5-oxide (PubChem CID 167484582) has the molecular formula C31H26F2N2OP+ and a molecular weight of 511.53 g/mol. Its IUPAC name is 3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,10-diphenylacridophosphine 5-oxide.
| Compound Name | 3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,10-diphenylacridophosphine 5-oxide |
|---|---|
| PubChem CID | 167484582 |
| Molecular Formula | C31H26F2N2OP+ |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 3-(3-fluoroazetidin-1-ium-1-ylidene)-7-(3-fluoroazetidin-1-yl)-5,10-diphenylacridophosphine 5-oxide |
| SMILES | O=P1(c2ccccc2)C2=CC(=[N+]3CC(F)C3)C=CC2=C(c2ccccc2)c2ccc(N3CC(F)C3)cc21 |
| InChI | InChI=1S/C31H26F2N2OP/c32-22-17-34(18-22)24-11-13-27-29(15-24)37(36,26-9-5-2-6-10-26)30-16-25(35-19-23(33)20-35)12-14-28(30)31(27)21-7-3-1-4-8-21/h1-16,22-23H,17-20H2/q+1 |
| InChIKey | HNXQAUMTBWZYSA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|