C19H22N2O — CID 57467092
5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenylphenol (PubChem CID 57467092) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenylphenol.
| Compound Name | 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenylphenol |
|---|---|
| PubChem CID | 57467092 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenylphenol |
| SMILES | CN1CC2CN(c3ccc(-c4ccccc4)c(O)c3)CC2C1 |
| InChI | InChI=1S/C19H22N2O/c1-20-10-15-12-21(13-16(15)11-20)17-7-8-18(19(22)9-17)14-5-3-2-4-6-14/h2-9,15-16,22H,10-13H2,1H3 |
| InChIKey | LJPRRSJHLTXACD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |