C15H19FN2O4 — CID 155345777
5-(2-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid (PubChem CID 155345777) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid.
| Compound Name | 5-(2-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid |
|---|---|
| PubChem CID | 155345777 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-(2-fluorophenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid |
| SMILES | CN1CC2CN(c3ccccc3F)CC2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H17FN2.C2H2O4/c1-15-6-10-8-16(9-11(10)7-15)13-5-3-2-4-12(13)14;3-1(4)2(5)6/h2-5,10-11H,6-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JKDRCNNLKCKQLN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|