C20H19F3N2O4S — CID 67163366
3-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]dibenzothiophene 5,5-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 67163366) has the molecular formula C20H19F3N2O4S and a molecular weight of 440.44 g/mol. Its IUPAC name is 3-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]dibenzothiophene 5,5-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]dibenzothiophene 5,5-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67163366 |
| Molecular Formula | C20H19F3N2O4S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]dibenzothiophene 5,5-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | CN1C[C@H]2CN(c3ccc4c(c3)S(=O)(=O)c3ccccc3-4)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18N2O2S.C2HF3O2/c1-19-9-12-10-20(11-16(12)19)13-6-7-15-14-4-2-3-5-17(14)23(21,22)18(15)8-13;3-2(4,5)1(6)7/h2-8,12,16H,9-11H2,1H3;(H,6,7)/t12-,16+;/m0./s1 |
| InChIKey | YZRXTYJTDMMLAB-CVHDTDHSSA-N |
| XLogP | 2.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |