C28H30F6N4O6S — CID 87293000
2,7-bis(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)dibenzothiophene 5,5-dioxide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87293000) has the molecular formula C28H30F6N4O6S and a molecular weight of 664.63 g/mol. Its IUPAC name is 2,7-bis(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)dibenzothiophene 5,5-dioxide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2,7-bis(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)dibenzothiophene 5,5-dioxide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87293000 |
| Molecular Formula | C28H30F6N4O6S |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.18 |
| IUPAC Name | 2,7-bis(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)dibenzothiophene 5,5-dioxide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S1(=O)c2ccc(N3CC4CNCC4C3)cc2-c2ccc(N3CC4CNCC4C3)cc21 |
| InChI | InChI=1S/C24H28N4O2S.2C2HF3O2/c29-31(30)23-4-2-19(27-11-15-7-25-8-16(15)12-27)5-22(23)21-3-1-20(6-24(21)31)28-13-17-9-26-10-18(17)14-28;2*3-2(4,5)1(6)7/h1-6,15-18,25-26H,7-14H2;2*(H,6,7) |
| InChIKey | JTKUCLRDHPSFDJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |