C11H12F3N2O3+ — CID 177362396
[4-(azetidin-3-yl)phenyl]-oxoazanium;2,2,2-trifluoroacetic acid (PubChem CID 177362396) has the molecular formula C11H12F3N2O3+ and a molecular weight of 277.22 g/mol. Its IUPAC name is [4-(azetidin-3-yl)phenyl]-oxoazanium;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(azetidin-3-yl)phenyl]-oxoazanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 177362396 |
| Molecular Formula | C11H12F3N2O3+ |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [4-(azetidin-3-yl)phenyl]-oxoazanium;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=[NH+]c1ccc(C2CNC2)cc1 |
| InChI | InChI=1S/C9H10N2O.C2HF3O2/c12-11-9-3-1-7(2-4-9)8-5-10-6-8;3-2(4,5)1(6)7/h1-4,8,10H,5-6H2;(H,6,7)/p+1 |
| InChIKey | BAQUDICLJRJPCL-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |