C13H18FNO2 — CID 174902483
butanoic acid;3-(4-fluorophenyl)azetidine (PubChem CID 174902483) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is butanoic acid;3-(4-fluorophenyl)azetidine.
| Compound Name | butanoic acid;3-(4-fluorophenyl)azetidine |
|---|---|
| PubChem CID | 174902483 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | butanoic acid;3-(4-fluorophenyl)azetidine |
| SMILES | CCCC(=O)O.Fc1ccc(C2CNC2)cc1 |
| InChI | InChI=1S/C9H10FN.C4H8O2/c10-9-3-1-7(2-4-9)8-5-11-6-8;1-2-3-4(5)6/h1-4,8,11H,5-6H2;2-3H2,1H3,(H,5,6) |
| InChIKey | LDISEFZSJZPROT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |