C26H23BrN2O4S — CID 57453851
[2-bromo-7-[(1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-9-oxofluoren-1-yl] 4-methylbenzenesulfonate (PubChem CID 57453851) has the molecular formula C26H23BrN2O4S and a molecular weight of 539.45 g/mol. Its IUPAC name is [2-bromo-7-[(1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-9-oxofluoren-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-7-[(1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-9-oxofluoren-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57453851 |
| Molecular Formula | C26H23BrN2O4S |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | [2-bromo-7-[(1S,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]-9-oxofluoren-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)ccc3c2C(=O)c2cc(N4C[C@@H]5CN(C)[C@H]5C4)ccc2-3)cc1 |
| InChI | InChI=1S/C26H23BrN2O4S/c1-15-3-6-18(7-4-15)34(31,32)33-26-22(27)10-9-20-19-8-5-17(11-21(19)25(30)24(20)26)29-13-16-12-28(2)23(16)14-29/h3-11,16,23H,12-14H2,1-2H3/t16-,23-/m0/s1 |
| InChIKey | PHZHCYXDSPMFOM-HJPURHCSSA-N |
| XLogP | 4.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|