C13H11BrO6S2 — CID 169336930
2-bromo-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid (PubChem CID 169336930) has the molecular formula C13H11BrO6S2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-bromo-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid.
| Compound Name | 2-bromo-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 169336930 |
| Molecular Formula | C13H11BrO6S2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 2-bromo-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Br)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H11BrO6S2/c1-9-2-5-11(6-3-9)22(18,19)20-10-4-7-12(14)13(8-10)21(15,16)17/h2-8H,1H3,(H,15,16,17) |
| InChIKey | UOAGYGSQTCXKID-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|