C13H11N3O6S2 — CID 169326018
2-azido-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid (PubChem CID 169326018) has the molecular formula C13H11N3O6S2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-azido-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid.
| Compound Name | 2-azido-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 169326018 |
| Molecular Formula | C13H11N3O6S2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-azido-5-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(N=[N+]=[N-])c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H11N3O6S2/c1-9-2-5-11(6-3-9)24(20,21)22-10-4-7-12(15-16-14)13(8-10)23(17,18)19/h2-8H,1H3,(H,17,18,19) |
| InChIKey | JSQCAVLDGFJGGY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|