C18H17Br2NO4S2 — CID 3114064
[2,6-dibromo-4-(morpholine-4-carbothioyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 3114064) has the molecular formula C18H17Br2NO4S2 and a molecular weight of 535.28 g/mol. Its IUPAC name is [2,6-dibromo-4-(morpholine-4-carbothioyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,6-dibromo-4-(morpholine-4-carbothioyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3114064 |
| Molecular Formula | C18H17Br2NO4S2 |
| Molecular Weight | 535.28 g/mol |
| Exact Mass | 532.90 |
| IUPAC Name | [2,6-dibromo-4-(morpholine-4-carbothioyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(C(=S)N3CCOCC3)cc2Br)cc1 |
| InChI | InChI=1S/C18H17Br2NO4S2/c1-12-2-4-14(5-3-12)27(22,23)25-17-15(19)10-13(11-16(17)20)18(26)21-6-8-24-9-7-21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | GRIJGGUYDSYORJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|