C21H25NO5S2 — CID 4018368
[2-ethoxy-4-(4-hydroxypiperidine-1-carbothioyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 4018368) has the molecular formula C21H25NO5S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is [2-ethoxy-4-(4-hydroxypiperidine-1-carbothioyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-(4-hydroxypiperidine-1-carbothioyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 4018368 |
| Molecular Formula | C21H25NO5S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [2-ethoxy-4-(4-hydroxypiperidine-1-carbothioyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C(=S)N2CCC(O)CC2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO5S2/c1-3-26-20-14-16(21(28)22-12-10-17(23)11-13-22)6-9-19(20)27-29(24,25)18-7-4-15(2)5-8-18/h4-9,14,17,23H,3,10-13H2,1-2H3 |
| InChIKey | YDSCNCMBRYRGBX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|