About 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one
2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one (PubChem CID 67163039) has the molecular formula C19H18N2O
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one.
Molecular Properties
| Compound Name | 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one |
| PubChem CID | 67163039 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one |
| SMILES | CN1C[C@@H]2CN(c3ccc4c(c3)C(=O)c3ccccc3-4)C[C@@H]21 |
| InChI | InChI=1S/C19H18N2O/c1-20-9-12-10-21(11-18(12)20)13-6-7-15-14-4-2-3-5-16(14)19(22)17(15)8-13/h2-8,12,18H,9-11H2,1H3/t12-,18+/m1/s1 |
| InChIKey | UHPGVQUSCBWVSI-XIKOKIGWSA-N |
| XLogP | 2.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one?
The IUPAC name of 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one (CID 67163039) is 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one.
What is the SMILES notation for 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one?
The canonical SMILES for 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one is CN1C[C@@H]2CN(c3ccc4c(c3)C(=O)c3ccccc3-4)C[C@@H]21.
What is the InChIKey of 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one?
The InChIKey is UHPGVQUSCBWVSI-XIKOKIGWSA-N. The full InChI is InChI=1S/C19H18N2O/c1-20-9-12-10-21(11-18(12)20)13-6-7-15-14-4-2-3-5-16(14)19(22)17(15)8-13/h2-8,12,18H,9-11H2,1H3/t12-,18+/m1/s1.
What are the key properties of 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one?
2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one has a molecular weight of 290.37 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5R)-6-methyl-3,6-diazabicyclo[3.2.0]heptan-3-yl]fluoren-9-one is sourced from PubChem (CID 67163039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).