About 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione
6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione (PubChem CID 106669917) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione.
Molecular Properties
| Compound Name | 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione |
| PubChem CID | 106669917 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione |
| SMILES | CN1C(=O)C(=O)c2ccc(N3CC(O)C(O)C3)cc21 |
| InChI | InChI=1S/C13H14N2O4/c1-14-9-4-7(15-5-10(16)11(17)6-15)2-3-8(9)12(18)13(14)19/h2-4,10-11,16-17H,5-6H2,1H3 |
| InChIKey | QZBUQVNLXIVBMO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione?
The IUPAC name of 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione (CID 106669917) is 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione.
What is the SMILES notation for 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione?
The canonical SMILES for 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione is CN1C(=O)C(=O)c2ccc(N3CC(O)C(O)C3)cc21.
What is the InChIKey of 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione?
The InChIKey is QZBUQVNLXIVBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-14-9-4-7(15-5-10(16)11(17)6-15)2-3-8(9)12(18)13(14)19/h2-4,10-11,16-17H,5-6H2,1H3.
What are the key properties of 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione?
6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione has a molecular weight of 262.26 g/mol, XLogP of -0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dihydroxypyrrolidin-1-yl)-1-methylindole-2,3-dione is sourced from PubChem (CID 106669917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).