C15H21N3O — CID 177042401
4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-methylbenzamide (PubChem CID 177042401) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-methylbenzamide.
| Compound Name | 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 177042401 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N2C[C@H]3CN(C)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-16-15(19)11-3-5-14(6-4-11)18-9-12-7-17(2)8-13(12)10-18/h3-6,12-13H,7-10H2,1-2H3,(H,16,19)/t12-,13+ |
| InChIKey | AFYITCDLNNKDJR-BETUJISGSA-N |
| XLogP | 1.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |