C27H31N2O2P — CID 147988149
[7-(diethylamino)-5-oxido-5-oxo-10-phenylacridophosphin-3-ylidene]-diethylazanium (PubChem CID 147988149) has the molecular formula C27H31N2O2P and a molecular weight of 446.53 g/mol. Its IUPAC name is [7-(diethylamino)-5-oxido-5-oxo-10-phenylacridophosphin-3-ylidene]-diethylazanium.
| Compound Name | [7-(diethylamino)-5-oxido-5-oxo-10-phenylacridophosphin-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 147988149 |
| Molecular Formula | C27H31N2O2P |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | [7-(diethylamino)-5-oxido-5-oxo-10-phenylacridophosphin-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(c1)P(=O)([O-])C1=CC(=[N+](CC)CC)C=CC1=C2c1ccccc1 |
| InChI | InChI=1S/C27H31N2O2P/c1-5-28(6-2)21-14-16-23-25(18-21)32(30,31)26-19-22(29(7-3)8-4)15-17-24(26)27(23)20-12-10-9-11-13-20/h9-19H,5-8H2,1-4H3 |
| InChIKey | VVJCBDMGKMHIPQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|