C49H72N3+ — CID 164543988
[7-(diethylamino)-10-[2-[1-[methyl-[(E)-octadec-9-enyl]amino]ethenyl]phenyl]-9H-anthracen-2-ylidene]-diethylazanium (PubChem CID 164543988) has the molecular formula C49H72N3+ and a molecular weight of 703.14 g/mol. Its IUPAC name is [7-(diethylamino)-10-[2-[1-[methyl-[(E)-octadec-9-enyl]amino]ethenyl]phenyl]-9H-anthracen-2-ylidene]-diethylazanium.
| Compound Name | [7-(diethylamino)-10-[2-[1-[methyl-[(E)-octadec-9-enyl]amino]ethenyl]phenyl]-9H-anthracen-2-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 164543988 |
| Molecular Formula | C49H72N3+ |
| Molecular Weight | 703.14 g/mol |
| Exact Mass | 702.57 |
| IUPAC Name | [7-(diethylamino)-10-[2-[1-[methyl-[(E)-octadec-9-enyl]amino]ethenyl]phenyl]-9H-anthracen-2-ylidene]-diethylazanium |
| SMILES | C=C(c1ccccc1C1=C2C=CC(=[N+](CC)CC)C=C2Cc2cc(N(CC)CC)ccc21)N(C)CCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C49H72N3/c1-8-13-14-15-16-17-18-19-20-21-22-23-24-25-26-29-36-50(7)40(6)45-30-27-28-31-48(45)49-46-34-32-43(51(9-2)10-3)38-41(46)37-42-39-44(33-35-47(42)49)52(11-4)12-5/h19-20,27-28,30-35,38-39H,6,8-18,21-26,29,36-37H2,1-5,7H3/q+1/b20-19+ |
| InChIKey | NZPAQFBKMKIGMN-FMQUCBEESA-N |
| XLogP | 12.82 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.14 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|