About CID 67343304
CID 67343304 (PubChem CID 67343304) has the molecular formula C13H18NSi
and a molecular weight of 216.38 g/mol.
Molecular Properties
| Compound Name | CID 67343304 |
| PubChem CID | 67343304 |
| Molecular Formula | C13H18NSi |
| Molecular Weight | 216.38 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | — |
| SMILES | C=C(c1ccccc1[Si])N(C)CCCC |
| InChI | InChI=1S/C13H18NSi/c1-4-5-10-14(3)11(2)12-8-6-7-9-13(12)15/h6-9H,2,4-5,10H2,1,3H3 |
| InChIKey | JSYRQUQZMYIERT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67343304 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67343304?
The IUPAC name of CID 67343304 (CID 67343304) is not available.
What is the SMILES notation for CID 67343304?
The canonical SMILES for CID 67343304 is C=C(c1ccccc1[Si])N(C)CCCC.
What is the InChIKey of CID 67343304?
The InChIKey is JSYRQUQZMYIERT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18NSi/c1-4-5-10-14(3)11(2)12-8-6-7-9-13(12)15/h6-9H,2,4-5,10H2,1,3H3.
What are the key properties of CID 67343304?
CID 67343304 has a molecular weight of 216.38 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67343304 is sourced from PubChem (CID 67343304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).