About 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine
1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine (PubChem CID 90395287) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine.
Analyze 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine?
The IUPAC name of 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine (CID 90395287) is 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine.
What is the SMILES notation for 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine?
The canonical SMILES for 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine is C=C(N(C)CCCC)N(C)CCCC.
What is the InChIKey of 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine?
The InChIKey is NXMVSMQARCSIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-6-8-10-13(4)12(3)14(5)11-9-7-2/h3,6-11H2,1-2,4-5H3.
What are the key properties of 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine?
1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N'-dibutyl-1-N,1-N'-dimethylethene-1,1-diamine is sourced from PubChem (CID 90395287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).