C35H40N2OP+ — CID 176741384
[7-(diethylamino)-10-(2,6-dimethylphenyl)-5-oxo-5-phenylacridophosphin-3-ylidene]-diethylazanium (PubChem CID 176741384) has the molecular formula C35H40N2OP+ and a molecular weight of 535.69 g/mol. Its IUPAC name is [7-(diethylamino)-10-(2,6-dimethylphenyl)-5-oxo-5-phenylacridophosphin-3-ylidene]-diethylazanium.
| Compound Name | [7-(diethylamino)-10-(2,6-dimethylphenyl)-5-oxo-5-phenylacridophosphin-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 176741384 |
| Molecular Formula | C35H40N2OP+ |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | [7-(diethylamino)-10-(2,6-dimethylphenyl)-5-oxo-5-phenylacridophosphin-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(c1)P(=O)(c1ccccc1)C1=CC(=[N+](CC)CC)C=CC1=C2c1c(C)cccc1C |
| InChI | InChI=1S/C35H40N2OP/c1-7-36(8-2)27-19-21-30-32(23-27)39(38,29-17-12-11-13-18-29)33-24-28(37(9-3)10-4)20-22-31(33)35(30)34-25(5)15-14-16-26(34)6/h11-24H,7-10H2,1-6H3/q+1 |
| InChIKey | VCXRTWMNXOUIEU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|