C37H44ClN2O4P — CID 142297887
4-[3,7-bis(diethylamino)-5-oxo-5-phenyl-10H-acridophosphin-10-yl]-3,5-dimethylbenzoic acid;methyl hypochlorite (PubChem CID 142297887) has the molecular formula C37H44ClN2O4P and a molecular weight of 647.20 g/mol. Its IUPAC name is 4-[3,7-bis(diethylamino)-5-oxo-5-phenyl-10H-acridophosphin-10-yl]-3,5-dimethylbenzoic acid;methyl hypochlorite.
| Compound Name | 4-[3,7-bis(diethylamino)-5-oxo-5-phenyl-10H-acridophosphin-10-yl]-3,5-dimethylbenzoic acid;methyl hypochlorite |
|---|---|
| PubChem CID | 142297887 |
| Molecular Formula | C37H44ClN2O4P |
| Molecular Weight | 647.20 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 4-[3,7-bis(diethylamino)-5-oxo-5-phenyl-10H-acridophosphin-10-yl]-3,5-dimethylbenzoic acid;methyl hypochlorite |
| SMILES | CCN(CC)c1ccc2c(c1)P(=O)(c1ccccc1)c1cc(N(CC)CC)ccc1C2c1c(C)cc(C(=O)O)cc1C.COCl |
| InChI | InChI=1S/C36H41N2O3P.CH3ClO/c1-7-37(8-2)27-16-18-30-32(22-27)42(41,29-14-12-11-13-15-29)33-23-28(38(9-3)10-4)17-19-31(33)35(30)34-24(5)20-26(36(39)40)21-25(34)6;1-3-2/h11-23,35H,7-10H2,1-6H3,(H,39,40);1H3 |
| InChIKey | IRQFIAPVBACJFR-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.20 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|