C27H33BrN2 — CID 173333229
3-N,3-N,6-N,6-N-tetraethyl-9-phenyl-9H-fluorene-3,6-diamine;hydrobromide (PubChem CID 173333229) has the molecular formula C27H33BrN2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetraethyl-9-phenyl-9H-fluorene-3,6-diamine;hydrobromide.
| Compound Name | 3-N,3-N,6-N,6-N-tetraethyl-9-phenyl-9H-fluorene-3,6-diamine;hydrobromide |
|---|---|
| PubChem CID | 173333229 |
| Molecular Formula | C27H33BrN2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetraethyl-9-phenyl-9H-fluorene-3,6-diamine;hydrobromide |
| SMILES | Br.CCN(CC)c1ccc2c(c1)-c1cc(N(CC)CC)ccc1C2c1ccccc1 |
| InChI | InChI=1S/C27H32N2.BrH/c1-5-28(6-2)21-14-16-23-25(18-21)26-19-22(29(7-3)8-4)15-17-24(26)27(23)20-12-10-9-11-13-20;/h9-19,27H,5-8H2,1-4H3;1H |
| InChIKey | ICKADASEUSYHLU-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|