C36H44ClN2O4P — CID 142297871
10-(2,6-dimethoxyphenyl)-3-N,3-N,7-N,7-N-tetraethyl-5-oxo-5-phenyl-10H-acridophosphine-3,7-diamine;methyl hypochlorite (PubChem CID 142297871) has the molecular formula C36H44ClN2O4P and a molecular weight of 635.19 g/mol. Its IUPAC name is 10-(2,6-dimethoxyphenyl)-3-N,3-N,7-N,7-N-tetraethyl-5-oxo-5-phenyl-10H-acridophosphine-3,7-diamine;methyl hypochlorite.
| Compound Name | 10-(2,6-dimethoxyphenyl)-3-N,3-N,7-N,7-N-tetraethyl-5-oxo-5-phenyl-10H-acridophosphine-3,7-diamine;methyl hypochlorite |
|---|---|
| PubChem CID | 142297871 |
| Molecular Formula | C36H44ClN2O4P |
| Molecular Weight | 635.19 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 10-(2,6-dimethoxyphenyl)-3-N,3-N,7-N,7-N-tetraethyl-5-oxo-5-phenyl-10H-acridophosphine-3,7-diamine;methyl hypochlorite |
| SMILES | CCN(CC)c1ccc2c(c1)P(=O)(c1ccccc1)c1cc(N(CC)CC)ccc1C2c1c(OC)cccc1OC.COCl |
| InChI | InChI=1S/C35H41N2O3P.CH3ClO/c1-7-36(8-2)25-19-21-28-32(23-25)41(38,27-15-12-11-13-16-27)33-24-26(37(9-3)10-4)20-22-29(33)34(28)35-30(39-5)17-14-18-31(35)40-6;1-3-2/h11-24,34H,7-10H2,1-6H3;1H3 |
| InChIKey | MYUPOEDREUCRSQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.19 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|