C31H40N3O4+ — CID 76578312
[4-[(3-carboxy-2-pyridinyl)-[4-(diethylamino)-2-ethoxyphenyl]methylidene]-3-ethoxycyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 76578312) has the molecular formula C31H40N3O4+ and a molecular weight of 518.68 g/mol. Its IUPAC name is [4-[(3-carboxy-2-pyridinyl)-[4-(diethylamino)-2-ethoxyphenyl]methylidene]-3-ethoxycyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[(3-carboxy-2-pyridinyl)-[4-(diethylamino)-2-ethoxyphenyl]methylidene]-3-ethoxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 76578312 |
| Molecular Formula | C31H40N3O4+ |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [4-[(3-carboxy-2-pyridinyl)-[4-(diethylamino)-2-ethoxyphenyl]methylidene]-3-ethoxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CCOC1=CC(=[N+](CC)CC)C=CC1=C(c1ccc(N(CC)CC)cc1OCC)c1ncccc1C(=O)O |
| InChI | InChI=1S/C31H39N3O4/c1-7-33(8-2)22-15-17-24(27(20-22)37-11-5)29(30-26(31(35)36)14-13-19-32-30)25-18-16-23(34(9-3)10-4)21-28(25)38-12-6/h13-21H,7-12H2,1-6H3/p+1 |
| InChIKey | CRTMOXZTLMRYCT-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|