C27H40N2O4 — CID 19867988
2,2-bis[4-(diethylamino)-2-ethoxyphenyl]propanoic acid (PubChem CID 19867988) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is 2,2-bis[4-(diethylamino)-2-ethoxyphenyl]propanoic acid.
| Compound Name | 2,2-bis[4-(diethylamino)-2-ethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 19867988 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 2,2-bis[4-(diethylamino)-2-ethoxyphenyl]propanoic acid |
| SMILES | CCOc1cc(N(CC)CC)ccc1C(C)(C(=O)O)c1ccc(N(CC)CC)cc1OCC |
| InChI | InChI=1S/C27H40N2O4/c1-8-28(9-2)20-14-16-22(24(18-20)32-12-5)27(7,26(30)31)23-17-15-21(29(10-3)11-4)19-25(23)33-13-6/h14-19H,8-13H2,1-7H3,(H,30,31) |
| InChIKey | WXROSAOJXVRHGV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|