C31H41N3O4 — CID 70973947
2-[bis[4-(diethylamino)-2-ethoxyphenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 70973947) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[bis[4-(diethylamino)-2-ethoxyphenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[bis[4-(diethylamino)-2-ethoxyphenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70973947 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 2-[bis[4-(diethylamino)-2-ethoxyphenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | CCOc1cc(N(CC)CC)ccc1C(c1ccc(N(CC)CC)cc1OCC)c1ncccc1C(=O)O |
| InChI | InChI=1S/C31H41N3O4/c1-7-33(8-2)22-15-17-24(27(20-22)37-11-5)29(30-26(31(35)36)14-13-19-32-30)25-18-16-23(34(9-3)10-4)21-28(25)38-12-6/h13-21,29H,7-12H2,1-6H3,(H,35,36) |
| InChIKey | WNVZTKHLQFMBQA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|