C31H41N5O3 — CID 158033603
8,8-bis[4-(diethylamino)-2-ethoxyphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one (PubChem CID 158033603) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 8,8-bis[4-(diethylamino)-2-ethoxyphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one.
| Compound Name | 8,8-bis[4-(diethylamino)-2-ethoxyphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 158033603 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 8,8-bis[4-(diethylamino)-2-ethoxyphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one |
| SMILES | CCOc1cc(N(CC)CC)ccc1C1(c2ccc(N(CC)CC)cc2OCC)NNC(=O)c2cccnc21 |
| InChI | InChI=1S/C31H41N5O3/c1-7-35(8-2)22-15-17-25(27(20-22)38-11-5)31(29-24(14-13-19-32-29)30(37)33-34-31)26-18-16-23(36(9-3)10-4)21-28(26)39-12-6/h13-21,34H,7-12H2,1-6H3,(H,33,37) |
| InChIKey | FHMBCSYLIZWRMV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|