C24H29N2O6+ — CID 57092048
carboxymethyl-[4-[3-[4-(diethylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-ethylazanium (PubChem CID 57092048) has the molecular formula C24H29N2O6+ and a molecular weight of 441.50 g/mol. Its IUPAC name is carboxymethyl-[4-[3-[4-(diethylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-ethylazanium.
| Compound Name | carboxymethyl-[4-[3-[4-(diethylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-ethylazanium |
|---|---|
| PubChem CID | 57092048 |
| Molecular Formula | C24H29N2O6+ |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | carboxymethyl-[4-[3-[4-(diethylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-ethylazanium |
| SMILES | CCN(CC)c1ccc(C2C(=O)C(=C3C=C/C(=[N+](/CC)CC(=O)O)C=C3O)C2O)c(O)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-4-25(5-2)14-7-9-16(18(27)11-14)21-23(31)22(24(21)32)17-10-8-15(12-19(17)28)26(6-3)13-20(29)30/h7-12,21,23,31H,4-6,13H2,1-3H3,(H2,27,29,30)/p+1 |
| InChIKey | VSBCNKVWMLZDKQ-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 121.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|