C24H21N2O12+ — CID 101421200
[4-[3-[4-[bis(carboxymethyl)amino]-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-bis(carboxymethyl)azanium (PubChem CID 101421200) has the molecular formula C24H21N2O12+ and a molecular weight of 529.43 g/mol. Its IUPAC name is [4-[3-[4-[bis(carboxymethyl)amino]-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-bis(carboxymethyl)azanium.
| Compound Name | [4-[3-[4-[bis(carboxymethyl)amino]-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-bis(carboxymethyl)azanium |
|---|---|
| PubChem CID | 101421200 |
| Molecular Formula | C24H21N2O12+ |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [4-[3-[4-[bis(carboxymethyl)amino]-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-bis(carboxymethyl)azanium |
| SMILES | O=C(O)CN(CC(=O)O)c1ccc(C2=C(O)C(=C3C=CC(=[N+](CC(=O)O)CC(=O)O)C=C3O)C2=O)c(O)c1 |
| InChI | InChI=1S/C24H20N2O12/c27-15-5-11(25(7-17(29)30)8-18(31)32)1-3-13(15)21-23(37)22(24(21)38)14-4-2-12(6-16(14)28)26(9-19(33)34)10-20(35)36/h1-6H,7-10H2,(H6,27,28,29,30,31,32,33,34,35,36,37,38)/p+1 |
| InChIKey | SXZKPBBWESZQHV-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 233.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|