C22H25N2O4+ — CID 123670654
[4-[3-[4-(dimethylamino)-2-hydroxyphenyl]-2,4-dioxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 123670654) has the molecular formula C22H25N2O4+ and a molecular weight of 381.45 g/mol. Its IUPAC name is [4-[3-[4-(dimethylamino)-2-hydroxyphenyl]-2,4-dioxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[3-[4-(dimethylamino)-2-hydroxyphenyl]-2,4-dioxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 123670654 |
| Molecular Formula | C22H25N2O4+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [4-[3-[4-(dimethylamino)-2-hydroxyphenyl]-2,4-dioxocyclobutylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C1C=CC(=C2C(=O)C(c3ccc(N(C)C)cc3O)C2=O)C(O)=C1 |
| InChI | InChI=1S/C22H24N2O4/c1-5-24(6-2)14-8-10-16(18(26)12-14)20-21(27)19(22(20)28)15-9-7-13(23(3)4)11-17(15)25/h7-12,19,25H,5-6H2,1-4H3/p+1/b20-16- |
| InChIKey | NNIVILQBXOMQMS-SILNSSARSA-O |
| XLogP | 2.50 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|