C43H67N2O3+ — CID 91099641
[4-[3-[4-(dihexylamino)-2-methylphenyl]-4-hydroxy-2,5-dioxocyclopentylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-dihexylazanium (PubChem CID 91099641) has the molecular formula C43H67N2O3+ and a molecular weight of 660.02 g/mol. Its IUPAC name is [4-[3-[4-(dihexylamino)-2-methylphenyl]-4-hydroxy-2,5-dioxocyclopentylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-dihexylazanium.
| Compound Name | [4-[3-[4-(dihexylamino)-2-methylphenyl]-4-hydroxy-2,5-dioxocyclopentylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-dihexylazanium |
|---|---|
| PubChem CID | 91099641 |
| Molecular Formula | C43H67N2O3+ |
| Molecular Weight | 660.02 g/mol |
| Exact Mass | 659.51 |
| IUPAC Name | [4-[3-[4-(dihexylamino)-2-methylphenyl]-4-hydroxy-2,5-dioxocyclopentylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-dihexylazanium |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C2C(=O)C(=C3C=CC(=[N+](CCCCCC)CCCCCC)C=C3C)C(=O)C2O)c(C)c1 |
| InChI | InChI=1S/C43H67N2O3/c1-7-11-15-19-27-44(28-20-16-12-8-2)35-23-25-37(33(5)31-35)39-41(46)40(43(48)42(39)47)38-26-24-36(32-34(38)6)45(29-21-17-13-9-3)30-22-18-14-10-4/h23-26,31-32,39,42,47H,7-22,27-30H2,1-6H3/q+1 |
| InChIKey | IAAAMUYXDIQVFZ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.02 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|