C46H57N2O4+ — CID 173464858
[3-hydroxy-4-[2-hydroxy-3-[2-hydroxy-4-(4-methyl-N-octylanilino)phenyl]-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-methylphenyl)-octylazanium (PubChem CID 173464858) has the molecular formula C46H57N2O4+ and a molecular weight of 701.97 g/mol. Its IUPAC name is [3-hydroxy-4-[2-hydroxy-3-[2-hydroxy-4-(4-methyl-N-octylanilino)phenyl]-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-methylphenyl)-octylazanium.
| Compound Name | [3-hydroxy-4-[2-hydroxy-3-[2-hydroxy-4-(4-methyl-N-octylanilino)phenyl]-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-methylphenyl)-octylazanium |
|---|---|
| PubChem CID | 173464858 |
| Molecular Formula | C46H57N2O4+ |
| Molecular Weight | 701.97 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | [3-hydroxy-4-[2-hydroxy-3-[2-hydroxy-4-(4-methyl-N-octylanilino)phenyl]-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-(4-methylphenyl)-octylazanium |
| SMILES | CCCCCCCCN(c1ccc(C)cc1)c1ccc(C2=C(O)C(=C3C=C/C(=[N+](/CCCCCCCC)c4ccc(C)cc4)C=C3O)C2=O)c(O)c1 |
| InChI | InChI=1S/C46H56N2O4/c1-5-7-9-11-13-15-29-47(35-21-17-33(3)18-22-35)37-25-27-39(41(49)31-37)43-45(51)44(46(43)52)40-28-26-38(32-42(40)50)48(30-16-14-12-10-8-6-2)36-23-19-34(4)20-24-36/h17-28,31-32H,5-16,29-30H2,1-4H3,(H2,49,50,51,52)/p+1 |
| InChIKey | CWJVOEAGLFGRID-UHFFFAOYSA-O |
| XLogP | 11.81 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.97 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|