C81H140N2O5 — CID 74009653
3-[4-[bis(2-hexyldecyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2-hexyldecyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 74009653) has the molecular formula C81H140N2O5 and a molecular weight of 1222.02 g/mol. Its IUPAC name is 3-[4-[bis(2-hexyldecyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2-hexyldecyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | 3-[4-[bis(2-hexyldecyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2-hexyldecyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 74009653 |
| Molecular Formula | C81H140N2O5 |
| Molecular Weight | 1222.02 g/mol |
| Exact Mass | 1221.08 |
| IUPAC Name | 3-[4-[bis(2-hexyldecyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2-hexyldecyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN(CC(CCCCCC)CCCCCCCC)C1=CC(=O)C(=C2C(=O)C(=O)C(c3ccc(N(CC(CCCCCC)CCCCCCCC)CC(CCCCCC)CCCCCCCC)cc3O)=C2O)C=C1 |
| InChI | InChI=1S/C81H140N2O5/c1-9-17-25-33-37-45-53-67(49-41-29-21-13-5)63-82(64-68(50-42-30-22-14-6)54-46-38-34-26-18-10-2)71-57-59-73(75(84)61-71)77-79(86)78(81(88)80(77)87)74-60-58-72(62-76(74)85)83(65-69(51-43-31-23-15-7)55-47-39-35-27-19-11-3)66-70(52-44-32-24-16-8)56-48-40-36-28-20-12-4/h57-62,67-70,84,86H,9-56,63-66H2,1-8H3 |
| InChIKey | FZHDNXBWJQXBGN-UHFFFAOYSA-N |
| XLogP | 24.59 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1222.02 |
| LogP ≤ 5 | 24.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|