C47H76N3O3+ — CID 173464905
[(6Z)-6-[3-[4-(dioctylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-pyridinylidene]-dioctylazanium (PubChem CID 173464905) has the molecular formula C47H76N3O3+ and a molecular weight of 731.14 g/mol. Its IUPAC name is [(6Z)-6-[3-[4-(dioctylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-pyridinylidene]-dioctylazanium.
| Compound Name | [(6Z)-6-[3-[4-(dioctylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-pyridinylidene]-dioctylazanium |
|---|---|
| PubChem CID | 173464905 |
| Molecular Formula | C47H76N3O3+ |
| Molecular Weight | 731.14 g/mol |
| Exact Mass | 730.59 |
| IUPAC Name | [(6Z)-6-[3-[4-(dioctylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]-3-pyridinylidene]-dioctylazanium |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(C2=C(O)/C(=C3\C=CC(=[N+](CCCCCCCC)CCCCCCCC)C=N3)C2=O)c(O)c1 |
| InChI | InChI=1S/C47H75N3O3/c1-5-9-13-17-21-25-33-49(34-26-22-18-14-10-6-2)39-29-31-41(43(51)37-39)44-46(52)45(47(44)53)42-32-30-40(38-48-42)50(35-27-23-19-15-11-7-3)36-28-24-20-16-12-8-4/h29-32,37-38H,5-28,33-36H2,1-4H3,(H,48,52,53)/p+1 |
| InChIKey | QPQJHLPIYICCIJ-UHFFFAOYSA-O |
| XLogP | 12.84 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.14 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|