C44H60N2O2S2 — CID 140909470
(4Z)-2-[6-(dihexylamino)-1-benzothiophen-2-yl]-4-(6-dihexylazaniumylidene-1-benzothiophen-2-ylidene)-3-oxocyclobuten-1-olate (PubChem CID 140909470) has the molecular formula C44H60N2O2S2 and a molecular weight of 713.11 g/mol. Its IUPAC name is (4Z)-2-[6-(dihexylamino)-1-benzothiophen-2-yl]-4-(6-dihexylazaniumylidene-1-benzothiophen-2-ylidene)-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-2-[6-(dihexylamino)-1-benzothiophen-2-yl]-4-(6-dihexylazaniumylidene-1-benzothiophen-2-ylidene)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140909470 |
| Molecular Formula | C44H60N2O2S2 |
| Molecular Weight | 713.11 g/mol |
| Exact Mass | 712.41 |
| IUPAC Name | (4Z)-2-[6-(dihexylamino)-1-benzothiophen-2-yl]-4-(6-dihexylazaniumylidene-1-benzothiophen-2-ylidene)-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCN(CCCCCC)c1ccc2cc(C3=C([O-])/C(=c4\cc5c(s4)=CC(=[N+](CCCCCC)CCCCCC)C=C5)C3=O)sc2c1 |
| InChI | InChI=1S/C44H60N2O2S2/c1-5-9-13-17-25-45(26-18-14-10-6-2)35-23-21-33-29-39(49-37(33)31-35)41-43(47)42(44(41)48)40-30-34-22-24-36(32-38(34)50-40)46(27-19-15-11-7-3)28-20-16-12-8-4/h21-24,29-32H,5-20,25-28H2,1-4H3 |
| InChIKey | ZIOOXKKIMCQHLU-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.11 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|