C37H56N2O3S2 — CID 169320374
(5Z)-2-[5-(dihexylamino)thiophen-2-yl]-5-(5-dihexylazaniumylidenethiophen-2-ylidene)-3,4-dioxocyclopenten-1-olate (PubChem CID 169320374) has the molecular formula C37H56N2O3S2 and a molecular weight of 641.00 g/mol. Its IUPAC name is (5Z)-2-[5-(dihexylamino)thiophen-2-yl]-5-(5-dihexylazaniumylidenethiophen-2-ylidene)-3,4-dioxocyclopenten-1-olate.
| Compound Name | (5Z)-2-[5-(dihexylamino)thiophen-2-yl]-5-(5-dihexylazaniumylidenethiophen-2-ylidene)-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 169320374 |
| Molecular Formula | C37H56N2O3S2 |
| Molecular Weight | 641.00 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | (5Z)-2-[5-(dihexylamino)thiophen-2-yl]-5-(5-dihexylazaniumylidenethiophen-2-ylidene)-3,4-dioxocyclopenten-1-olate |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C2=C([O-])/C(=C3\C=CC(=[N+](CCCCCC)CCCCCC)S3)C(=O)C2=O)s1 |
| InChI | InChI=1S/C37H56N2O3S2/c1-5-9-13-17-25-38(26-18-14-10-6-2)31-23-21-29(43-31)33-35(40)34(37(42)36(33)41)30-22-24-32(44-30)39(27-19-15-11-7-3)28-20-16-12-8-4/h21-24H,5-20,25-28H2,1-4H3 |
| InChIKey | HHOLOOOGHVWBQK-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.00 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|