C32H44N2S2 — CID 102193736
2-[4-(dibutylamino)phenyl]-4-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3-sulfanylidenecyclobutene-1-thiolate (PubChem CID 102193736) has the molecular formula C32H44N2S2 and a molecular weight of 520.85 g/mol. Its IUPAC name is 2-[4-(dibutylamino)phenyl]-4-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3-sulfanylidenecyclobutene-1-thiolate.
| Compound Name | 2-[4-(dibutylamino)phenyl]-4-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3-sulfanylidenecyclobutene-1-thiolate |
|---|---|
| PubChem CID | 102193736 |
| Molecular Formula | C32H44N2S2 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-[4-(dibutylamino)phenyl]-4-(4-dibutylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-3-sulfanylidenecyclobutene-1-thiolate |
| SMILES | CCCCN(CCCC)c1ccc(C2=C([S-])C(=C3C=CC(=[N+](CCCC)CCCC)C=C3)C2=S)cc1 |
| InChI | InChI=1S/C32H44N2S2/c1-5-9-21-33(22-10-6-2)27-17-13-25(14-18-27)29-31(35)30(32(29)36)26-15-19-28(20-16-26)34(23-11-7-3)24-12-8-4/h13-20H,5-12,21-24H2,1-4H3 |
| InChIKey | QBVBLSFAZNXAOU-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|