C40H55N2O10+ — CID 89016802
[4-[3-[4-[bis(4-ethoxy-4-oxobutyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-bis(4-ethoxy-4-oxobutyl)azanium (PubChem CID 89016802) has the molecular formula C40H55N2O10+ and a molecular weight of 723.88 g/mol. Its IUPAC name is [4-[3-[4-[bis(4-ethoxy-4-oxobutyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-bis(4-ethoxy-4-oxobutyl)azanium.
| Compound Name | [4-[3-[4-[bis(4-ethoxy-4-oxobutyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-bis(4-ethoxy-4-oxobutyl)azanium |
|---|---|
| PubChem CID | 89016802 |
| Molecular Formula | C40H55N2O10+ |
| Molecular Weight | 723.88 g/mol |
| Exact Mass | 723.39 |
| IUPAC Name | [4-[3-[4-[bis(4-ethoxy-4-oxobutyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-bis(4-ethoxy-4-oxobutyl)azanium |
| SMILES | CCOC(=O)CCCN(CCCC(=O)OCC)c1ccc(C2=C(O)C(C3C=CC(=[N+](CCCC(=O)OCC)CCCC(=O)OCC)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C40H54N2O10/c1-5-49-33(43)13-9-25-41(26-10-14-34(44)50-6-2)31-21-17-29(18-22-31)37-39(47)38(40(37)48)30-19-23-32(24-20-30)42(27-11-15-35(45)51-7-3)28-12-16-36(46)52-8-4/h17-24,29,37H,5-16,25-28H2,1-4H3/p+1 |
| InChIKey | CPQAUUQFKKAHAO-UHFFFAOYSA-O |
| XLogP | 5.53 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|