C28H37N4O4+ — CID 142298232
3-acetamidopropyl-[4-[(1R)-3-[4-[3-acetamidopropyl(methyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-methylazanium (PubChem CID 142298232) has the molecular formula C28H37N4O4+ and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-acetamidopropyl-[4-[(1R)-3-[4-[3-acetamidopropyl(methyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-methylazanium.
| Compound Name | 3-acetamidopropyl-[4-[(1R)-3-[4-[3-acetamidopropyl(methyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
|---|---|
| PubChem CID | 142298232 |
| Molecular Formula | C28H37N4O4+ |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 3-acetamidopropyl-[4-[(1R)-3-[4-[3-acetamidopropyl(methyl)amino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
| SMILES | CC(=O)NCCCN(C)c1ccc(C2=C(O)[C@@H](C3C=CC(=[N+](C)CCCNC(C)=O)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C28H36N4O4/c1-19(33)29-15-5-17-31(3)23-11-7-21(8-12-23)25-27(35)26(28(25)36)22-9-13-24(14-10-22)32(4)18-6-16-30-20(2)34/h7-14,21,25H,5-6,15-18H2,1-4H3,(H2-,29,30,33,34,35,36)/p+1/b31-23- |
| InChIKey | JDIDAPWDPSMBNA-SXBRIOAWSA-O |
| XLogP | 2.47 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|