C24H31N2O6+ — CID 90803608
[4-[3-[4-(diethylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 90803608) has the molecular formula C24H31N2O6+ and a molecular weight of 443.52 g/mol. Its IUPAC name is [4-[3-[4-(diethylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[3-[4-(diethylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 90803608 |
| Molecular Formula | C24H31N2O6+ |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | [4-[3-[4-(diethylamino)-2,6-dihydroxyphenyl]-2-hydroxy-4-oxocyclobutylidene]-3,5-dihydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1cc(O)c(C2C(=O)C(=C3C(O)=CC(=[N+](CC)CC)C=C3O)C2O)c(O)c1 |
| InChI | InChI=1S/C24H30N2O6/c1-5-25(6-2)13-9-15(27)19(16(28)10-13)21-23(31)22(24(21)32)20-17(29)11-14(12-18(20)30)26(7-3)8-4/h9-12,21,23,31H,5-8H2,1-4H3,(H3,27,28,29,30)/p+1 |
| InChIKey | KSFXWPKZECMTGR-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|