C32H48N2O4+2 — CID 57321881
[3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxoniumylidenecyclobutylidene]cyclohexa-2,4-dien-1-ylidene]oxidanium (PubChem CID 57321881) has the molecular formula C32H48N2O4+2 and a molecular weight of 524.75 g/mol. Its IUPAC name is [3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxoniumylidenecyclobutylidene]cyclohexa-2,4-dien-1-ylidene]oxidanium.
| Compound Name | [3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxoniumylidenecyclobutylidene]cyclohexa-2,4-dien-1-ylidene]oxidanium |
|---|---|
| PubChem CID | 57321881 |
| Molecular Formula | C32H48N2O4+2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | [3-(dibutylamino)-6-[3-[4-(dibutylamino)-2-hydroxyphenyl]-2-hydroxy-4-oxoniumylidenecyclobutylidene]cyclohexa-2,4-dien-1-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\C=C(N(CCCC)CCCC)C=CC1=C1/C(=[O+]/[H])C(c2ccc(N(CCCC)CCCC)cc2O)C1O |
| InChI | InChI=1S/C32H46N2O4/c1-5-9-17-33(18-10-6-2)23-13-15-25(27(35)21-23)29-31(37)30(32(29)38)26-16-14-24(22-28(26)36)34(19-11-7-3)20-12-8-4/h13-16,21-22,29,31,35,37H,5-12,17-20H2,1-4H3/p+2 |
| InChIKey | XVNBFCGCZNZUSM-UHFFFAOYSA-P |
| XLogP | 6.00 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|