C27H33N2+ — CID 3014214
[4-[[2-[4-(diethylamino)phenyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 3014214) has the molecular formula C27H33N2+ and a molecular weight of 385.58 g/mol. Its IUPAC name is [4-[[2-[4-(diethylamino)phenyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[[2-[4-(diethylamino)phenyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 3014214 |
| Molecular Formula | C27H33N2+ |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | [4-[[2-[4-(diethylamino)phenyl]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc(-c2ccccc2C=C2C=CC(=[N+](CC)CC)C=C2)cc1 |
| InChI | InChI=1S/C27H33N2/c1-5-28(6-2)25-17-13-22(14-18-25)21-24-11-9-10-12-27(24)23-15-19-26(20-16-23)29(7-3)8-4/h9-21H,5-8H2,1-4H3/q+1 |
| InChIKey | PYUFBXJZHNSEAT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|