C35H44N3O+ — CID 139768892
[4-[4,6-bis[4-(diethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 139768892) has the molecular formula C35H44N3O+ and a molecular weight of 522.76 g/mol. Its IUPAC name is [4-[4,6-bis[4-(diethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [4-[4,6-bis[4-(diethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 139768892 |
| Molecular Formula | C35H44N3O+ |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | [4-[4,6-bis[4-(diethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc(C2=CC(=C3C=CC(=[N+](CC)CC)C=C3)OC(c3ccc(N(CC)CC)cc3)=C2)cc1 |
| InChI | InChI=1S/C35H44N3O/c1-7-36(8-2)31-19-13-27(14-20-31)30-25-34(28-15-21-32(22-16-28)37(9-3)10-4)39-35(26-30)29-17-23-33(24-18-29)38(11-5)12-6/h13-26H,7-12H2,1-6H3/q+1 |
| InChIKey | VPOJLJPYNLCXSB-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|