C47H54N5O3+ — CID 54349576
[4-[4,6-bis[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;bis(4-(dimethylamino)benzaldehyde) (PubChem CID 54349576) has the molecular formula C47H54N5O3+ and a molecular weight of 736.98 g/mol. Its IUPAC name is [4-[4,6-bis[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;bis(4-(dimethylamino)benzaldehyde).
| Compound Name | [4-[4,6-bis[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;bis(4-(dimethylamino)benzaldehyde) |
|---|---|
| PubChem CID | 54349576 |
| Molecular Formula | C47H54N5O3+ |
| Molecular Weight | 736.98 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | [4-[4,6-bis[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;bis(4-(dimethylamino)benzaldehyde) |
| SMILES | CN(C)c1ccc(C2=CC(=C3C=CC(=[N+](C)C)C=C3)OC(c3ccc(N(C)C)cc3)=C2)cc1.CN(C)c1ccc(C=O)cc1.CN(C)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C29H32N3O.2C9H11NO/c1-30(2)25-13-7-21(8-14-25)24-19-28(22-9-15-26(16-10-22)31(3)4)33-29(20-24)23-11-17-27(18-12-23)32(5)6;2*1-10(2)9-5-3-8(7-11)4-6-9/h7-20H,1-6H3;2*3-7H,1-2H3/q+1;; |
| InChIKey | UETVKBNRHABAFS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 59.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.98 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|