C31H34N3O+ — CID 20660068
2-[4-[2,6-bis[4-(dimethylamino)phenyl]pyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]ethylidene-dimethylazanium (PubChem CID 20660068) has the molecular formula C31H34N3O+ and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-[4-[2,6-bis[4-(dimethylamino)phenyl]pyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]ethylidene-dimethylazanium.
| Compound Name | 2-[4-[2,6-bis[4-(dimethylamino)phenyl]pyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]ethylidene-dimethylazanium |
|---|---|
| PubChem CID | 20660068 |
| Molecular Formula | C31H34N3O+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-[4-[2,6-bis[4-(dimethylamino)phenyl]pyran-4-ylidene]cyclohexa-2,5-dien-1-ylidene]ethylidene-dimethylazanium |
| SMILES | CN(C)c1ccc(C2=CC(=c3ccc(=CC=[N+](C)C)cc3)C=C(c3ccc(N(C)C)cc3)O2)cc1 |
| InChI | InChI=1S/C31H34N3O/c1-32(2)20-19-23-7-9-24(10-8-23)27-21-30(25-11-15-28(16-12-25)33(3)4)35-31(22-27)26-13-17-29(18-14-26)34(5)6/h7-22H,1-6H3/q+1 |
| InChIKey | IWELSMNPRVOEOJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|