C35H33N2O+ — CID 3092824
[4-[1-[4-(dimethylamino)phenyl]-2-(4,6-diphenylpyran-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 3092824) has the molecular formula C35H33N2O+ and a molecular weight of 497.66 g/mol. Its IUPAC name is [4-[1-[4-(dimethylamino)phenyl]-2-(4,6-diphenylpyran-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[1-[4-(dimethylamino)phenyl]-2-(4,6-diphenylpyran-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 3092824 |
| Molecular Formula | C35H33N2O+ |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [4-[1-[4-(dimethylamino)phenyl]-2-(4,6-diphenylpyran-2-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(C(C=C2C=C(c3ccccc3)C=C(c3ccccc3)O2)=C2C=CC(=[N+](C)C)C=C2)cc1 |
| InChI | InChI=1S/C35H33N2O/c1-36(2)31-19-15-27(16-20-31)34(28-17-21-32(22-18-28)37(3)4)25-33-23-30(26-11-7-5-8-12-26)24-35(38-33)29-13-9-6-10-14-29/h5-25H,1-4H3/q+1 |
| InChIKey | IQCWBJTXDDGDME-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|